C22H26F2N2O4 — CID 44609024
tert-butyl 4-[[2,6-difluoro-4-(1-oxidopyridin-1-ium-4-yl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 44609024) has the molecular formula C22H26F2N2O4 and a molecular weight of 420.46 g/mol. Its IUPAC name is tert-butyl 4-[[2,6-difluoro-4-(1-oxidopyridin-1-ium-4-yl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2,6-difluoro-4-(1-oxidopyridin-1-ium-4-yl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 44609024 |
| Molecular Formula | C22H26F2N2O4 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | tert-butyl 4-[[2,6-difluoro-4-(1-oxidopyridin-1-ium-4-yl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2c(F)cc(-c3cc[n+]([O-])cc3)cc2F)CC1 |
| InChI | InChI=1S/C22H26F2N2O4/c1-22(2,3)30-21(27)25-8-4-15(5-9-25)14-29-20-18(23)12-17(13-19(20)24)16-6-10-26(28)11-7-16/h6-7,10-13,15H,4-5,8-9,14H2,1-3H3 |
| InChIKey | FQGHIFLBSMRNDO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|