C18H24N2O5 — CID 168567590
dimethyl (E)-2-[2-[(4-hydroxycyclohexyl)amino]anilino]but-2-enedioate (PubChem CID 168567590) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[(4-hydroxycyclohexyl)amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[(4-hydroxycyclohexyl)amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567590 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | dimethyl (E)-2-[2-[(4-hydroxycyclohexyl)amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1NC1CCC(O)CC1)C(=O)OC |
| InChI | InChI=1S/C18H24N2O5/c1-24-17(22)11-16(18(23)25-2)20-15-6-4-3-5-14(15)19-12-7-9-13(21)10-8-12/h3-6,11-13,19-21H,7-10H2,1-2H3/b16-11+ |
| InChIKey | PGDVYJDRMMLIDZ-LFIBNONCSA-N |
| XLogP | 2.04 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|