C24H37NO3 — CID 156864591
tert-butyl 2-(5-tert-butyl-2-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 156864591) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is tert-butyl 2-(5-tert-butyl-2-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-(5-tert-butyl-2-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 156864591 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl 2-(5-tert-butyl-2-methoxyphenyl)-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | COc1ccc(C(C)(C)C)cc1C1CC2(CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C24H37NO3/c1-22(2,3)18-8-9-20(27-7)19(14-18)17-15-24(16-17)10-12-25(13-11-24)21(26)28-23(4,5)6/h8-9,14,17H,10-13,15-16H2,1-7H3 |
| InChIKey | ICKIXAKTGUULIY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |