C29H38N4O7 — CID 175913972
bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone;formic acid (PubChem CID 175913972) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone;formic acid.
| Compound Name | bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 175913972 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | bis[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]methanone;formic acid |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C(=O)n1cc(CCN(C)C)c2cc(OC)ccc21.O=CO.O=CO |
| InChI | InChI=1S/C27H34N4O3.2CH2O2/c1-28(2)13-11-19-17-30(25-9-7-21(33-5)15-23(19)25)27(32)31-18-20(12-14-29(3)4)24-16-22(34-6)8-10-26(24)31;2*2-1-3/h7-10,15-18H,11-14H2,1-6H3;2*1H,(H,2,3) |
| InChIKey | ZSHKVLQUZKYDKM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|