C18H27N3O2 — CID 166467388
2-amino-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-3-methylbutan-1-one (PubChem CID 166467388) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-amino-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-3-methylbutan-1-one.
| Compound Name | 2-amino-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 166467388 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-amino-1-[3-[2-(dimethylamino)ethyl]-5-methoxyindol-1-yl]-3-methylbutan-1-one |
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C(=O)C(N)C(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-12(2)17(19)18(22)21-11-13(8-9-20(3)4)15-10-14(23-5)6-7-16(15)21/h6-7,10-12,17H,8-9,19H2,1-5H3 |
| InChIKey | PHCUPKOGPVRSMR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |