C29H31N2O10P — CID 167307231
[[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-(phenoxycarbonyloxymethoxy)phosphoryl]oxymethyl phenyl carbonate (PubChem CID 167307231) has the molecular formula C29H31N2O10P and a molecular weight of 598.55 g/mol. Its IUPAC name is [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-(phenoxycarbonyloxymethoxy)phosphoryl]oxymethyl phenyl carbonate.
| Compound Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-(phenoxycarbonyloxymethoxy)phosphoryl]oxymethyl phenyl carbonate |
|---|---|
| PubChem CID | 167307231 |
| Molecular Formula | C29H31N2O10P |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]methoxy-(phenoxycarbonyloxymethoxy)phosphoryl]oxymethyl phenyl carbonate |
| SMILES | CN(C)CCc1cn(COP(=O)(OCOC(=O)Oc2ccccc2)OCOC(=O)Oc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C29H31N2O10P/c1-30(2)18-17-23-19-31(27-16-10-9-15-26(23)27)20-37-42(34,38-21-35-28(32)40-24-11-5-3-6-12-24)39-22-36-29(33)41-25-13-7-4-8-14-25/h3-16,19H,17-18,20-22H2,1-2H3 |
| InChIKey | OYVGUWQPHLHHQA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 123.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|