C27H31N2O3P — CID 172854299
2-[1-[bis(phenylmethoxy)phosphorylmethyl]indol-3-yl]-N,N-bis(trideuteriomethyl)ethanamine (PubChem CID 172854299) has the molecular formula C27H31N2O3P and a molecular weight of 468.57 g/mol. Its IUPAC name is 2-[1-[bis(phenylmethoxy)phosphorylmethyl]indol-3-yl]-N,N-bis(trideuteriomethyl)ethanamine.
| Compound Name | 2-[1-[bis(phenylmethoxy)phosphorylmethyl]indol-3-yl]-N,N-bis(trideuteriomethyl)ethanamine |
|---|---|
| PubChem CID | 172854299 |
| Molecular Formula | C27H31N2O3P |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-[1-[bis(phenylmethoxy)phosphorylmethyl]indol-3-yl]-N,N-bis(trideuteriomethyl)ethanamine |
| SMILES | [2H]C([2H])([2H])N(CCc1cn(CP(=O)(OCc2ccccc2)OCc2ccccc2)c2ccccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H31N2O3P/c1-28(2)18-17-25-19-29(27-16-10-9-15-26(25)27)22-33(30,31-20-23-11-5-3-6-12-23)32-21-24-13-7-4-8-14-24/h3-16,19H,17-18,20-22H2,1-2H3/i1D3,2D3 |
| InChIKey | YMIBJLONELAMDI-WFGJKAKNSA-N |
| XLogP | 6.33 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|