C18H25N2O3P — CID 166467723
2-(1-dicyclopropyloxyphosphorylindol-3-yl)-N,N-dimethylethanamine (PubChem CID 166467723) has the molecular formula C18H25N2O3P and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-(1-dicyclopropyloxyphosphorylindol-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(1-dicyclopropyloxyphosphorylindol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 166467723 |
| Molecular Formula | C18H25N2O3P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(1-dicyclopropyloxyphosphorylindol-3-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cn(P(=O)(OC2CC2)OC2CC2)c2ccccc12 |
| InChI | InChI=1S/C18H25N2O3P/c1-19(2)12-11-14-13-20(18-6-4-3-5-17(14)18)24(21,22-15-7-8-15)23-16-9-10-16/h3-6,13,15-16H,7-12H2,1-2H3 |
| InChIKey | HEWHHYRQTCRYET-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|