C28H35N4O7P — CID 166467397
[[3-[2-(dimethylamino)ethyl]indol-1-yl]-[(1-methyl-4H-pyridine-3-carbonyl)oxymethoxy]phosphoryl]oxymethyl 1-methyl-4H-pyridine-3-carboxylate (PubChem CID 166467397) has the molecular formula C28H35N4O7P and a molecular weight of 570.58 g/mol. Its IUPAC name is [[3-[2-(dimethylamino)ethyl]indol-1-yl]-[(1-methyl-4H-pyridine-3-carbonyl)oxymethoxy]phosphoryl]oxymethyl 1-methyl-4H-pyridine-3-carboxylate.
| Compound Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]-[(1-methyl-4H-pyridine-3-carbonyl)oxymethoxy]phosphoryl]oxymethyl 1-methyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 166467397 |
| Molecular Formula | C28H35N4O7P |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | [[3-[2-(dimethylamino)ethyl]indol-1-yl]-[(1-methyl-4H-pyridine-3-carbonyl)oxymethoxy]phosphoryl]oxymethyl 1-methyl-4H-pyridine-3-carboxylate |
| SMILES | CN1C=CCC(C(=O)OCOP(=O)(OCOC(=O)C2=CN(C)C=CC2)n2cc(CCN(C)C)c3ccccc32)=C1 |
| InChI | InChI=1S/C28H35N4O7P/c1-29(2)16-13-22-19-32(26-12-6-5-11-25(22)26)40(35,38-20-36-27(33)23-9-7-14-30(3)17-23)39-21-37-28(34)24-10-8-15-31(4)18-24/h5-8,11-12,14-15,17-19H,9-10,13,16,20-21H2,1-4H3 |
| InChIKey | PKMNCYPNZILVIY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|