C22H29N3O3 — CID 176589062
[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxymethyl 1-propan-2-yl-4H-pyridine-3-carboxylate (PubChem CID 176589062) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxymethyl 1-propan-2-yl-4H-pyridine-3-carboxylate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxymethyl 1-propan-2-yl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 176589062 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxymethyl 1-propan-2-yl-4H-pyridine-3-carboxylate |
| SMILES | CC(C)N1C=CCC(C(=O)OCOc2cccc3[nH]cc(CCN(C)C)c23)=C1 |
| InChI | InChI=1S/C22H29N3O3/c1-16(2)25-11-6-7-18(14-25)22(26)28-15-27-20-9-5-8-19-21(20)17(13-23-19)10-12-24(3)4/h5-6,8-9,11,13-14,16,23H,7,10,12,15H2,1-4H3 |
| InChIKey | VRTCDFRQDOYIIK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|