C28H31N4O4+ — CID 10096922
(Z)-3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 10096922) has the molecular formula C28H31N4O4+ and a molecular weight of 487.58 g/mol. Its IUPAC name is (Z)-3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (Z)-3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 10096922 |
| Molecular Formula | C28H31N4O4+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (Z)-3-[2-(1-benzylindol-3-yl)ethyl-hex-5-enoylamino]-1-ethoxy-1-hydroxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | C=CCCCC(=O)N(CCc1cn(Cc2ccccc2)c2ccccc12)C(=O)/C([N+]#N)=C(\O)OCC |
| InChI | InChI=1S/C28H30N4O4/c1-3-5-7-16-25(33)32(27(34)26(30-29)28(35)36-4-2)18-17-22-20-31(19-21-12-8-6-9-13-21)24-15-11-10-14-23(22)24/h3,6,8-15,20H,1,4-5,7,16-19H2,2H3/p+1 |
| InChIKey | VOQQFURCMCNIBP-UHFFFAOYSA-O |
| XLogP | 5.56 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|