C27H28N2O8 — CID 10673227
2-[(1S,2S)-1-(1-benzylindol-3-yl)-3-ethoxy-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]propanedioic acid (PubChem CID 10673227) has the molecular formula C27H28N2O8 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-[(1S,2S)-1-(1-benzylindol-3-yl)-3-ethoxy-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]propanedioic acid.
| Compound Name | 2-[(1S,2S)-1-(1-benzylindol-3-yl)-3-ethoxy-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]propanedioic acid |
|---|---|
| PubChem CID | 10673227 |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2-[(1S,2S)-1-(1-benzylindol-3-yl)-3-ethoxy-3-oxo-2-(prop-2-enoxycarbonylamino)propyl]propanedioic acid |
| SMILES | C=CCOC(=O)N[C@H](C(=O)OCC)[C@H](c1cn(Cc2ccccc2)c2ccccc12)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H28N2O8/c1-3-14-37-27(35)28-23(26(34)36-4-2)21(22(24(30)31)25(32)33)19-16-29(15-17-10-6-5-7-11-17)20-13-9-8-12-18(19)20/h3,5-13,16,21-23H,1,4,14-15H2,2H3,(H,28,35)(H,30,31)(H,32,33)/t21-,23+/m1/s1 |
| InChIKey | YZPMNUOHJNLNSD-GGAORHGYSA-N |
| XLogP | 3.40 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|