C24H25NO2 — CID 54300784
ethyl 5-(1-benzylindol-3-yl)-2-ethylpenta-2,4-dienoate (PubChem CID 54300784) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 5-(1-benzylindol-3-yl)-2-ethylpenta-2,4-dienoate.
| Compound Name | ethyl 5-(1-benzylindol-3-yl)-2-ethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 54300784 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | ethyl 5-(1-benzylindol-3-yl)-2-ethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C(=CC=Cc1cn(Cc2ccccc2)c2ccccc12)CC |
| InChI | InChI=1S/C24H25NO2/c1-3-20(24(26)27-4-2)13-10-14-21-18-25(17-19-11-6-5-7-12-19)23-16-9-8-15-22(21)23/h5-16,18H,3-4,17H2,1-2H3 |
| InChIKey | SDZZBCJDYRCYQJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|