C35H48N2O3SSi2 — CID 42604319
N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-(trimethylsilylmethyl)-1-trimethylsilyloxybut-3-enyl]benzenesulfonamide (PubChem CID 42604319) has the molecular formula C35H48N2O3SSi2 and a molecular weight of 633.02 g/mol. Its IUPAC name is N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-(trimethylsilylmethyl)-1-trimethylsilyloxybut-3-enyl]benzenesulfonamide.
| Compound Name | N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-(trimethylsilylmethyl)-1-trimethylsilyloxybut-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42604319 |
| Molecular Formula | C35H48N2O3SSi2 |
| Molecular Weight | 633.02 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-(trimethylsilylmethyl)-1-trimethylsilyloxybut-3-enyl]benzenesulfonamide |
| SMILES | C=C(CC(O[Si](C)(C)C)N(CCc1cn(Cc2ccccc2)c2ccccc12)S(=O)(=O)c1ccc(C)cc1)C[Si](C)(C)C |
| InChI | InChI=1S/C35H48N2O3SSi2/c1-28-18-20-32(21-19-28)41(38,39)37(35(40-43(6,7)8)24-29(2)27-42(3,4)5)23-22-31-26-36(25-30-14-10-9-11-15-30)34-17-13-12-16-33(31)34/h9-21,26,35H,2,22-25,27H2,1,3-8H3 |
| InChIKey | ZRYUJQLFKWTFTK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.02 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|