C37H46N2O3SSi — CID 154586030
N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-tri(propan-2-yl)silyloxybut-3-en-1-ynyl]benzenesulfonamide (PubChem CID 154586030) has the molecular formula C37H46N2O3SSi and a molecular weight of 626.94 g/mol. Its IUPAC name is N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-tri(propan-2-yl)silyloxybut-3-en-1-ynyl]benzenesulfonamide.
| Compound Name | N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-tri(propan-2-yl)silyloxybut-3-en-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154586030 |
| Molecular Formula | C37H46N2O3SSi |
| Molecular Weight | 626.94 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | N-[2-(1-benzylindol-3-yl)ethyl]-4-methyl-N-[3-tri(propan-2-yl)silyloxybut-3-en-1-ynyl]benzenesulfonamide |
| SMILES | C=C(C#CN(CCc1cn(Cc2ccccc2)c2ccccc12)S(=O)(=O)c1ccc(C)cc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H46N2O3SSi/c1-28(2)44(29(3)4,30(5)6)42-32(8)22-24-39(43(40,41)35-20-18-31(7)19-21-35)25-23-34-27-38(26-33-14-10-9-11-15-33)37-17-13-12-16-36(34)37/h9-21,27-30H,8,23,25-26H2,1-7H3 |
| InChIKey | BORHDDBKQVABCV-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.94 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|