C26H24Cl2N2O2S — CID 154585991
N-[2-(1-benzylindol-3-yl)ethyl]-N-[(E)-1,2-dichloroethenyl]-4-methylbenzenesulfonamide (PubChem CID 154585991) has the molecular formula C26H24Cl2N2O2S and a molecular weight of 499.46 g/mol. Its IUPAC name is N-[2-(1-benzylindol-3-yl)ethyl]-N-[(E)-1,2-dichloroethenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(1-benzylindol-3-yl)ethyl]-N-[(E)-1,2-dichloroethenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154585991 |
| Molecular Formula | C26H24Cl2N2O2S |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-[2-(1-benzylindol-3-yl)ethyl]-N-[(E)-1,2-dichloroethenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCc2cn(Cc3ccccc3)c3ccccc23)/C(Cl)=C\Cl)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O2S/c1-20-11-13-23(14-12-20)33(31,32)30(26(28)17-27)16-15-22-19-29(18-21-7-3-2-4-8-21)25-10-6-5-9-24(22)25/h2-14,17,19H,15-16,18H2,1H3/b26-17- |
| InChIKey | NFQRFVFFDKGMNF-ONUIUJJFSA-N |
| XLogP | 6.51 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|