C28H32N3O4S+ — CID 163717520
[4-[benzyl-[2-[1-(carboxymethyl)indol-3-yl]ethyl]sulfamoyl]phenyl]-trimethylazanium (PubChem CID 163717520) has the molecular formula C28H32N3O4S+ and a molecular weight of 506.65 g/mol. Its IUPAC name is [4-[benzyl-[2-[1-(carboxymethyl)indol-3-yl]ethyl]sulfamoyl]phenyl]-trimethylazanium.
| Compound Name | [4-[benzyl-[2-[1-(carboxymethyl)indol-3-yl]ethyl]sulfamoyl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 163717520 |
| Molecular Formula | C28H32N3O4S+ |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [4-[benzyl-[2-[1-(carboxymethyl)indol-3-yl]ethyl]sulfamoyl]phenyl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1ccc(S(=O)(=O)N(CCc2cn(CC(=O)O)c3ccccc23)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O4S/c1-31(2,3)24-13-15-25(16-14-24)36(34,35)30(19-22-9-5-4-6-10-22)18-17-23-20-29(21-28(32)33)27-12-8-7-11-26(23)27/h4-16,20H,17-19,21H2,1-3H3/p+1 |
| InChIKey | KOQXOFQSYBFIKP-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|