C25H25N3O4S — CID 170652551
2-[3-[2-[(2-amino-4-benzylphenyl)sulfamoyl]ethyl]indol-1-yl]acetic acid (PubChem CID 170652551) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[3-[2-[(2-amino-4-benzylphenyl)sulfamoyl]ethyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-[(2-amino-4-benzylphenyl)sulfamoyl]ethyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 170652551 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[3-[2-[(2-amino-4-benzylphenyl)sulfamoyl]ethyl]indol-1-yl]acetic acid |
| SMILES | Nc1cc(Cc2ccccc2)ccc1NS(=O)(=O)CCc1cn(CC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C25H25N3O4S/c26-22-15-19(14-18-6-2-1-3-7-18)10-11-23(22)27-33(31,32)13-12-20-16-28(17-25(29)30)24-9-5-4-8-21(20)24/h1-11,15-16,27H,12-14,17,26H2,(H,29,30) |
| InChIKey | BSQUXZJZHBDXES-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|