2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid

C14H13N3O2 — CID 70575857

IUPAC2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid
SMILESO=C(O)Cn1cc(Cc2ncc[nH]2)c2ccccc21
InChIInChI=1S/C14H13N3O2/c18-14(19)9-17-8-10(7-13-15-5-6-16-13)11-3-1-2-4-12(11)17/h1-6,8H,7,9H2,(H,15,16)(H,18,19)
InChIKeyOLWCXDSZSGVCAS-UHFFFAOYSA-N
MW255.28 g/mol
LogP2.04
Rot. Bonds4

About 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid

2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid (PubChem CID 70575857) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid
PubChem CID70575857
Molecular FormulaC14H13N3O2
Molecular Weight255.28 g/mol
Exact Mass255.10
IUPAC Name2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid
SMILESO=C(O)Cn1cc(Cc2ncc[nH]2)c2ccccc21
InChIInChI=1S/C14H13N3O2/c18-14(19)9-17-8-10(7-13-15-5-6-16-13)11-3-1-2-4-12(11)17/h1-6,8H,7,9H2,(H,15,16)(H,18,19)
InChIKeyOLWCXDSZSGVCAS-UHFFFAOYSA-N
XLogP2.04
TPSA70.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.28
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-[2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]ethyl]cyclopropanecarboxamide
CID 70574636
2-[3-(hydroxymethyl)indol-1-yl]acetic acid
CID 15089421
2-[3-[(pyridin-2-ylmethylamino)methyl]indol-1-yl]acetic acid
CID 102535957
2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]-4-phenyl-1,3-thiazole;hydrochloride
CID 67905815
2-[3-[(propan-2-ylamino)methyl]indol-1-yl]acetic acid
CID 83776315
1-(carboxymethyl)indole-3-carboxylic acid
CID 14914502
2-[3-[(pyridin-3-ylmethylamino)methyl]indol-1-yl]acetic acid
CID 102535946
acetic acid;2-[3-(pyrrolidin-1-ylmethyl)indol-1-yl]acetic acid
CID 46736509
3-[[1-[3-[(2-oxo-1H-pyrazin-3-yl)methyl]indol-1-yl]indol-3-yl]methyl]-1H-pyrazin-2-one
CID 102339996
5-fluoro-2-methylquinoline;2-[3-(quinolin-2-ylmethyl)indol-1-yl]acetic acid
CID 174803754
2-[1-(3-methylbut-2-enyl)indol-3-yl]acetic acid
CID 28599761
2-[1-(pyridin-4-ylmethyl)indol-3-yl]acetic acid
CID 22071716

Frequently Asked Questions

What is the IUPAC name of 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid?
The IUPAC name of 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid (CID 70575857) is 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid?
The canonical SMILES for 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid is O=C(O)Cn1cc(Cc2ncc[nH]2)c2ccccc21.
What is the InChIKey of 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid?
The InChIKey is OLWCXDSZSGVCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c18-14(19)9-17-8-10(7-13-15-5-6-16-13)11-3-1-2-4-12(11)17/h1-6,8H,7,9H2,(H,15,16)(H,18,19).
What are the key properties of 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid?
2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid has a molecular weight of 255.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1H-imidazol-2-ylmethyl)indol-1-yl]acetic acid is sourced from PubChem (CID 70575857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).