C17H17N3O2 — CID 102535957
2-[3-[(pyridin-2-ylmethylamino)methyl]indol-1-yl]acetic acid (PubChem CID 102535957) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[3-[(pyridin-2-ylmethylamino)methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(pyridin-2-ylmethylamino)methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 102535957 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-[3-[(pyridin-2-ylmethylamino)methyl]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNCc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O2/c21-17(22)12-20-11-13(15-6-1-2-7-16(15)20)9-18-10-14-5-3-4-8-19-14/h1-8,11,18H,9-10,12H2,(H,21,22) |
| InChIKey | KCTHNOHFPZAFJL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |