C27H29N3O4S — CID 163565640
2-[3-[2-[benzyl-[4-(dimethylamino)phenyl]sulfonylamino]ethyl]indol-1-yl]acetic acid (PubChem CID 163565640) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-[3-[2-[benzyl-[4-(dimethylamino)phenyl]sulfonylamino]ethyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-[benzyl-[4-(dimethylamino)phenyl]sulfonylamino]ethyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 163565640 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[3-[2-[benzyl-[4-(dimethylamino)phenyl]sulfonylamino]ethyl]indol-1-yl]acetic acid |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(CCc2cn(CC(=O)O)c3ccccc23)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-28(2)23-12-14-24(15-13-23)35(33,34)30(18-21-8-4-3-5-9-21)17-16-22-19-29(20-27(31)32)26-11-7-6-10-25(22)26/h3-15,19H,16-18,20H2,1-2H3,(H,31,32) |
| InChIKey | FUYJBTCAGTXFNP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |