C18H26ClN3O2S — CID 120895835
N-(2-aminoethyl)-4-(dimethylamino)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride (PubChem CID 120895835) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(dimethylamino)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-(dimethylamino)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120895835 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-(2-aminoethyl)-4-(dimethylamino)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(CCN)CCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H25N3O2S.ClH/c1-20(2)17-8-10-18(11-9-17)24(22,23)21(15-13-19)14-12-16-6-4-3-5-7-16;/h3-11H,12-15,19H2,1-2H3;1H |
| InChIKey | XAFDREYRVKRABV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |