C15H23ClN4O2S — CID 120895703
N-(2-aminoethyl)-1-ethyl-N-(2-phenylethyl)pyrazole-4-sulfonamide;hydrochloride (PubChem CID 120895703) has the molecular formula C15H23ClN4O2S and a molecular weight of 358.90 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-ethyl-N-(2-phenylethyl)pyrazole-4-sulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-ethyl-N-(2-phenylethyl)pyrazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120895703 |
| Molecular Formula | C15H23ClN4O2S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-(2-aminoethyl)-1-ethyl-N-(2-phenylethyl)pyrazole-4-sulfonamide;hydrochloride |
| SMILES | CCn1cc(S(=O)(=O)N(CCN)CCc2ccccc2)cn1.Cl |
| InChI | InChI=1S/C15H22N4O2S.ClH/c1-2-18-13-15(12-17-18)22(20,21)19(11-9-16)10-8-14-6-4-3-5-7-14;/h3-7,12-13H,2,8-11,16H2,1H3;1H |
| InChIKey | WYRQCUAQSSPLEK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |