C18H25ClN2O3S — CID 120895906
N-(2-aminoethyl)-4-(methoxymethyl)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride (PubChem CID 120895906) has the molecular formula C18H25ClN2O3S and a molecular weight of 384.93 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(methoxymethyl)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-(methoxymethyl)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120895906 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(2-aminoethyl)-4-(methoxymethyl)-N-(2-phenylethyl)benzenesulfonamide;hydrochloride |
| SMILES | COCc1ccc(S(=O)(=O)N(CCN)CCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H24N2O3S.ClH/c1-23-15-17-7-9-18(10-8-17)24(21,22)20(14-12-19)13-11-16-5-3-2-4-6-16;/h2-10H,11-15,19H2,1H3;1H |
| InChIKey | PTNRXRLPQTXBMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |