C18H22Cl2N2O4S — CID 120895713
methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-5-chlorobenzoate;hydrochloride (PubChem CID 120895713) has the molecular formula C18H22Cl2N2O4S and a molecular weight of 433.36 g/mol. Its IUPAC name is methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-5-chlorobenzoate;hydrochloride.
| Compound Name | methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-5-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 120895713 |
| Molecular Formula | C18H22Cl2N2O4S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-5-chlorobenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(Cl)cc(S(=O)(=O)N(CCN)CCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C18H21ClN2O4S.ClH/c1-25-18(22)15-11-16(19)13-17(12-15)26(23,24)21(10-8-20)9-7-14-5-3-2-4-6-14;/h2-6,11-13H,7-10,20H2,1H3;1H |
| InChIKey | YDYIYSUUAGQYEA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |