C20H26N2O4S — CID 120895879
methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 120895879) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 120895879 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | methyl 3-[2-aminoethyl(2-phenylethyl)sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C)c(C)c(S(=O)(=O)N(CCN)CCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-15-13-18(20(23)26-3)14-19(16(15)2)27(24,25)22(12-10-21)11-9-17-7-5-4-6-8-17/h4-8,13-14H,9-12,21H2,1-3H3 |
| InChIKey | PYZLUEWFNLGLKT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |