C22H25N5O4S — CID 162406572
tert-butyl 3-[2-[azidosulfonyl(benzyl)amino]ethyl]indole-1-carboxylate (PubChem CID 162406572) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is tert-butyl 3-[2-[azidosulfonyl(benzyl)amino]ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[azidosulfonyl(benzyl)amino]ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 162406572 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | tert-butyl 3-[2-[azidosulfonyl(benzyl)amino]ethyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CCN(Cc2ccccc2)S(=O)(=O)N=[N+]=[N-])c2ccccc21 |
| InChI | InChI=1S/C22H25N5O4S/c1-22(2,3)31-21(28)27-16-18(19-11-7-8-12-20(19)27)13-14-26(32(29,30)25-24-23)15-17-9-5-4-6-10-17/h4-12,16H,13-15H2,1-3H3 |
| InChIKey | WYFVDEHSDVLTAO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 117.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|