C17H20N4O4 — CID 170183884
(3S)-2-azido-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid (PubChem CID 170183884) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (3S)-2-azido-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid.
| Compound Name | (3S)-2-azido-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 170183884 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (3S)-2-azido-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid |
| SMILES | C[C@@H](c1cn(C(=O)OC(C)(C)C)c2ccccc12)C(N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C17H20N4O4/c1-10(14(15(22)23)19-20-18)12-9-21(16(24)25-17(2,3)4)13-8-6-5-7-11(12)13/h5-10,14H,1-4H3,(H,22,23)/t10-,14?/m0/s1 |
| InChIKey | JFYDLJYDRYQCHW-XLLULAGJSA-N |
| XLogP | 4.29 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|