C32H34N2O4 — CID 102205707
tert-butyl 3-[2-[[(1S)-1-phenylethyl]-[(2R,3S)-3-phenyloxirane-2-carbonyl]amino]ethyl]indole-1-carboxylate (PubChem CID 102205707) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is tert-butyl 3-[2-[[(1S)-1-phenylethyl]-[(2R,3S)-3-phenyloxirane-2-carbonyl]amino]ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[[(1S)-1-phenylethyl]-[(2R,3S)-3-phenyloxirane-2-carbonyl]amino]ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 102205707 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | tert-butyl 3-[2-[[(1S)-1-phenylethyl]-[(2R,3S)-3-phenyloxirane-2-carbonyl]amino]ethyl]indole-1-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N(CCc1cn(C(=O)OC(C)(C)C)c2ccccc12)C(=O)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H34N2O4/c1-22(23-13-7-5-8-14-23)33(30(35)29-28(37-29)24-15-9-6-10-16-24)20-19-25-21-34(31(36)38-32(2,3)4)27-18-12-11-17-26(25)27/h5-18,21-22,28-29H,19-20H2,1-4H3/t22-,28-,29+/m0/s1 |
| InChIKey | XDTYMMHOZPKCLO-PWUSVURUSA-N |
| XLogP | 6.70 |
| TPSA | 64.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|