C60H56N4O4S2 — CID 139148652
N-[(1R)-1-(1-benzylindol-3-yl)-1-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 139148652) has the molecular formula C60H56N4O4S2 and a molecular weight of 961.27 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzylindol-3-yl)-1-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(1-benzylindol-3-yl)-1-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139148652 |
| Molecular Formula | C60H56N4O4S2 |
| Molecular Weight | 961.27 g/mol |
| Exact Mass | 960.37 |
| IUPAC Name | N-[(1R)-1-(1-benzylindol-3-yl)-1-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@](C)(c2ccccc2)c2cn(Cc3ccccc3)c3ccccc23)cc1.Cc1ccc(S(=O)(=O)N[C@](C)(c2ccccc2)c2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/2C30H28N2O2S/c2*1-23-17-19-26(20-18-23)35(33,34)31-30(2,25-13-7-4-8-14-25)28-22-32(21-24-11-5-3-6-12-24)29-16-10-9-15-27(28)29/h2*3-20,22,31H,21H2,1-2H3/t2*30-/m11/s1 |
| InChIKey | BABPQSYNHQDIFF-OQSVIDKASA-N |
| XLogP | 12.48 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.27 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |