C24H20F2N2O4S — CID 175472714
1-[[4-(difluoromethoxy)phenyl]methyl]-N-(4-methylphenyl)sulfonylindole-3-carboxamide (PubChem CID 175472714) has the molecular formula C24H20F2N2O4S and a molecular weight of 470.50 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-N-(4-methylphenyl)sulfonylindole-3-carboxamide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-N-(4-methylphenyl)sulfonylindole-3-carboxamide |
|---|---|
| PubChem CID | 175472714 |
| Molecular Formula | C24H20F2N2O4S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-N-(4-methylphenyl)sulfonylindole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2cn(Cc3ccc(OC(F)F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H20F2N2O4S/c1-16-6-12-19(13-7-16)33(30,31)27-23(29)21-15-28(22-5-3-2-4-20(21)22)14-17-8-10-18(11-9-17)32-24(25)26/h2-13,15,24H,14H2,1H3,(H,27,29) |
| InChIKey | LGCUFAQNWCPIIV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |