C23H16F2N4O4S — CID 166984505
N-(4-cyanophenyl)sulfonyl-1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3-carboxamide (PubChem CID 166984505) has the molecular formula C23H16F2N4O4S and a molecular weight of 482.47 g/mol. Its IUPAC name is N-(4-cyanophenyl)sulfonyl-1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3-carboxamide.
| Compound Name | N-(4-cyanophenyl)sulfonyl-1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 166984505 |
| Molecular Formula | C23H16F2N4O4S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-(4-cyanophenyl)sulfonyl-1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(=O)c2nn(Cc3ccc(OC(F)F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H16F2N4O4S/c24-23(25)33-17-9-5-16(6-10-17)14-29-20-4-2-1-3-19(20)21(27-29)22(30)28-34(31,32)18-11-7-15(13-26)8-12-18/h1-12,23H,14H2,(H,28,30) |
| InChIKey | IGCCIRVFYYVZSN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |