C21H14Cl2N4O5S — CID 175040525
1-[(3,4-dichlorophenyl)methyl]-N-(4-nitrophenyl)sulfonylindazole-3-carboxamide (PubChem CID 175040525) has the molecular formula C21H14Cl2N4O5S and a molecular weight of 505.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-(4-nitrophenyl)sulfonylindazole-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-(4-nitrophenyl)sulfonylindazole-3-carboxamide |
|---|---|
| PubChem CID | 175040525 |
| Molecular Formula | C21H14Cl2N4O5S |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-(4-nitrophenyl)sulfonylindazole-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1nn(Cc2ccc(Cl)c(Cl)c2)c2ccccc12 |
| InChI | InChI=1S/C21H14Cl2N4O5S/c22-17-10-5-13(11-18(17)23)12-26-19-4-2-1-3-16(19)20(24-26)21(28)25-33(31,32)15-8-6-14(7-9-15)27(29)30/h1-11H,12H2,(H,25,28) |
| InChIKey | XDZPJMYNNNMJBM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|