C33H29Cl2N5O7S — CID 155137277
5-chloro-1-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-(3-morpholin-4-yl-4-nitrophenyl)sulfonylindazole-3-carboxamide (PubChem CID 155137277) has the molecular formula C33H29Cl2N5O7S and a molecular weight of 710.60 g/mol. Its IUPAC name is 5-chloro-1-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-(3-morpholin-4-yl-4-nitrophenyl)sulfonylindazole-3-carboxamide.
| Compound Name | 5-chloro-1-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-(3-morpholin-4-yl-4-nitrophenyl)sulfonylindazole-3-carboxamide |
|---|---|
| PubChem CID | 155137277 |
| Molecular Formula | C33H29Cl2N5O7S |
| Molecular Weight | 710.60 g/mol |
| Exact Mass | 709.12 |
| IUPAC Name | 5-chloro-1-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-(3-morpholin-4-yl-4-nitrophenyl)sulfonylindazole-3-carboxamide |
| SMILES | Cc1cc(Oc2ccc(Cn3nc(C(=O)NS(=O)(=O)c4ccc([N+](=O)[O-])c(N5CCOCC5)c4)c4cc(Cl)ccc43)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C33H29Cl2N5O7S/c1-20-15-25(16-21(2)31(20)35)47-24-6-3-22(4-7-24)19-39-28-9-5-23(34)17-27(28)32(36-39)33(41)37-48(44,45)26-8-10-29(40(42)43)30(18-26)38-11-13-46-14-12-38/h3-10,15-18H,11-14,19H2,1-2H3,(H,37,41) |
| InChIKey | RHWOKPFKJGOQKS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|