C40H39ClN4O10S2 — CID 135238752
5-[benzyl-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]sulfonylamino]-2-hydroxy-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide (PubChem CID 135238752) has the molecular formula C40H39ClN4O10S2 and a molecular weight of 835.36 g/mol. Its IUPAC name is 5-[benzyl-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]sulfonylamino]-2-hydroxy-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 5-[benzyl-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]sulfonylamino]-2-hydroxy-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 135238752 |
| Molecular Formula | C40H39ClN4O10S2 |
| Molecular Weight | 835.36 g/mol |
| Exact Mass | 834.18 |
| IUPAC Name | 5-[benzyl-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]sulfonylamino]-2-hydroxy-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonylbenzamide |
| SMILES | Cc1cc(Oc2ccc(S(=O)(=O)N(Cc3ccccc3)c3ccc(O)c(C(=O)NS(=O)(=O)c4ccc(NCC5CCOCC5)c([N+](=O)[O-])c4)c3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C40H39ClN4O10S2/c1-26-20-32(21-27(2)39(26)41)55-31-9-11-33(12-10-31)57(52,53)44(25-29-6-4-3-5-7-29)30-8-15-38(46)35(22-30)40(47)43-56(50,51)34-13-14-36(37(23-34)45(48)49)42-24-28-16-18-54-19-17-28/h3-15,20-23,28,42,46H,16-19,24-25H2,1-2H3,(H,43,47) |
| InChIKey | HOKHQIRCCKCANV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 194.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.36 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|