C28H29N5O6S — CID 162475349
4-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)benzamide (PubChem CID 162475349) has the molecular formula C28H29N5O6S and a molecular weight of 563.64 g/mol. Its IUPAC name is 4-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)benzamide.
| Compound Name | 4-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 162475349 |
| Molecular Formula | C28H29N5O6S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 4-methyl-N-[3-nitro-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2ccc(NCC3CCOCC3)c([N+](=O)[O-])c2)c(Cc2cnc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C28H29N5O6S/c1-18-2-4-24(22(12-18)14-20-13-21-6-9-29-27(21)31-17-20)28(34)32-40(37,38)23-3-5-25(26(15-23)33(35)36)30-16-19-7-10-39-11-8-19/h2-6,9,12-13,15,17,19,30H,7-8,10-11,14,16H2,1H3,(H,29,31)(H,32,34) |
| InChIKey | PFWVIJKPMNSCFZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 156.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|