C23H18F3N3O2 — CID 141202072
N-benzyl-1-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroindazole-3-carboxamide (PubChem CID 141202072) has the molecular formula C23H18F3N3O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-benzyl-1-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroindazole-3-carboxamide.
| Compound Name | N-benzyl-1-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroindazole-3-carboxamide |
|---|---|
| PubChem CID | 141202072 |
| Molecular Formula | C23H18F3N3O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-benzyl-1-[[4-(difluoromethoxy)phenyl]methyl]-5-fluoroindazole-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1nn(Cc2ccc(OC(F)F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C23H18F3N3O2/c24-17-8-11-20-19(12-17)21(22(30)27-13-15-4-2-1-3-5-15)28-29(20)14-16-6-9-18(10-7-16)31-23(25)26/h1-12,23H,13-14H2,(H,27,30) |
| InChIKey | PNUYPEFSYYQWID-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |