C27H31N3O6 — CID 85285015
ethyl 3-[benzyl-[4-[(3,4-dimethoxyphenyl)methyl]hex-5-enoyl]amino]-2-diazo-3-oxopropanoate (PubChem CID 85285015) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 3-[benzyl-[4-[(3,4-dimethoxyphenyl)methyl]hex-5-enoyl]amino]-2-diazo-3-oxopropanoate.
| Compound Name | ethyl 3-[benzyl-[4-[(3,4-dimethoxyphenyl)methyl]hex-5-enoyl]amino]-2-diazo-3-oxopropanoate |
|---|---|
| PubChem CID | 85285015 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | ethyl 3-[benzyl-[4-[(3,4-dimethoxyphenyl)methyl]hex-5-enoyl]amino]-2-diazo-3-oxopropanoate |
| SMILES | C=CC(CCC(=O)N(Cc1ccccc1)C(=O)C(=[N+]=[N-])C(=O)OCC)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H31N3O6/c1-5-19(16-21-12-14-22(34-3)23(17-21)35-4)13-15-24(31)30(18-20-10-8-7-9-11-20)26(32)25(29-28)27(33)36-6-2/h5,7-12,14,17,19H,1,6,13,15-16,18H2,2-4H3 |
| InChIKey | YFDHWLUGBNEGHY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|