C26H29NO4 — CID 134869017
ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]acetate (PubChem CID 134869017) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]acetate |
|---|---|
| PubChem CID | 134869017 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(c1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H29NO4/c1-4-31-25(28)19-27(18-20-11-7-5-8-12-20)26(21-13-9-6-10-14-21)22-15-16-23(29-2)24(17-22)30-3/h5-17,26H,4,18-19H2,1-3H3 |
| InChIKey | MVRLAPRYWXURKS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |