C27H31NO4 — CID 134868833
ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]propanoate (PubChem CID 134868833) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]propanoate.
| Compound Name | ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]propanoate |
|---|---|
| PubChem CID | 134868833 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | ethyl 2-[benzyl-[(3,4-dimethoxyphenyl)-phenylmethyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)N(Cc1ccccc1)C(c1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H31NO4/c1-5-32-27(29)20(2)28(19-21-12-8-6-9-13-21)26(22-14-10-7-11-15-22)23-16-17-24(30-3)25(18-23)31-4/h6-18,20,26H,5,19H2,1-4H3 |
| InChIKey | LHEYKYZSVYGLAD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |