C20H24O2 — CID 134844752
1,2-dimethoxy-4-[(2R)-2-(2-phenylethyl)but-3-enyl]benzene (PubChem CID 134844752) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(2R)-2-(2-phenylethyl)but-3-enyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(2R)-2-(2-phenylethyl)but-3-enyl]benzene |
|---|---|
| PubChem CID | 134844752 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1,2-dimethoxy-4-[(2R)-2-(2-phenylethyl)but-3-enyl]benzene |
| SMILES | C=C[C@H](CCc1ccccc1)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24O2/c1-4-16(10-11-17-8-6-5-7-9-17)14-18-12-13-19(21-2)20(15-18)22-3/h4-9,12-13,15-16H,1,10-11,14H2,2-3H3/t16-/m1/s1 |
| InChIKey | NUUUPUGGJKBZMV-MRXNPFEDSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|