C20H20N6 — CID 101017415
N-[2-(1-benzylindol-3-yl)ethyl]-6-methyl-1,2,4,5-tetrazin-3-amine (PubChem CID 101017415) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[2-(1-benzylindol-3-yl)ethyl]-6-methyl-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-[2-(1-benzylindol-3-yl)ethyl]-6-methyl-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 101017415 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[2-(1-benzylindol-3-yl)ethyl]-6-methyl-1,2,4,5-tetrazin-3-amine |
| SMILES | Cc1nnc(NCCc2cn(Cc3ccccc3)c3ccccc23)nn1 |
| InChI | InChI=1S/C20H20N6/c1-15-22-24-20(25-23-15)21-12-11-17-14-26(13-16-7-3-2-4-8-16)19-10-6-5-9-18(17)19/h2-10,14H,11-13H2,1H3,(H,21,24,25) |
| InChIKey | LBRDURQPQODXPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |