C12H13N3O3S — CID 124662033
(Z)-3-(furan-2-yl)-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 124662033) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is (Z)-3-(furan-2-yl)-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(furan-2-yl)-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 124662033 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (Z)-3-(furan-2-yl)-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | CCCc1nc(S/C(=C\c2ccco2)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C12H13N3O3S/c1-2-4-10-13-12(15-14-10)19-9(11(16)17)7-8-5-3-6-18-8/h3,5-7H,2,4H2,1H3,(H,16,17)(H,13,14,15)/b9-7- |
| InChIKey | PKRXESAUIQHLFG-CLFYSBASSA-N |
| XLogP | 2.57 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|