C10H11ClN4S — CID 56772716
5-chloro-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 56772716) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 5-chloro-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline.
| Compound Name | 5-chloro-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 56772716 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-chloro-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | CCc1nc(Sc2ccc(Cl)cc2N)n[nH]1 |
| InChI | InChI=1S/C10H11ClN4S/c1-2-9-13-10(15-14-9)16-8-4-3-6(11)5-7(8)12/h3-5H,2,12H2,1H3,(H,13,14,15) |
| InChIKey | SSUZBJAWCRPFKI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|