About 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline
5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 66080387) has the molecular formula C9H9IN4S
and a molecular weight of 332.17 g/mol. Its IUPAC name is 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
| PubChem CID | 66080387 |
| Molecular Formula | C9H9IN4S |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | Cc1nc(Sc2ccc(I)cc2N)n[nH]1 |
| InChI | InChI=1S/C9H9IN4S/c1-5-12-9(14-13-5)15-8-3-2-6(10)4-7(8)11/h2-4H,11H2,1H3,(H,12,13,14) |
| InChIKey | HHFZPTVDNWYDIC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline?
The IUPAC name of 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline (CID 66080387) is 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline.
What is the SMILES notation for 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline?
The canonical SMILES for 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline is Cc1nc(Sc2ccc(I)cc2N)n[nH]1.
What is the InChIKey of 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline?
The InChIKey is HHFZPTVDNWYDIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN4S/c1-5-12-9(14-13-5)15-8-3-2-6(10)4-7(8)11/h2-4H,11H2,1H3,(H,12,13,14).
What are the key properties of 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline?
5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline has a molecular weight of 332.17 g/mol, XLogP of 2.45, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline is sourced from PubChem (CID 66080387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).