C19H19IN4O2S — CID 126196821
(Z)-3-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid (PubChem CID 126196821) has the molecular formula C19H19IN4O2S and a molecular weight of 494.36 g/mol. Its IUPAC name is (Z)-3-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126196821 |
| Molecular Formula | C19H19IN4O2S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | (Z)-3-[1-(3-iodo-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]prop-2-enoic acid |
| SMILES | Cc1nc(S/C(=C\c2cc(C)n(-c3ccc(C)c(I)c3)c2C)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C19H19IN4O2S/c1-10-5-6-15(9-16(10)20)24-11(2)7-14(12(24)3)8-17(18(25)26)27-19-21-13(4)22-23-19/h5-9H,1-4H3,(H,25,26)(H,21,22,23)/b17-8- |
| InChIKey | ZUWRXJVNQFMOQZ-IUXPMGMMSA-N |
| XLogP | 4.65 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|