C18H16ClN4O2S- — CID 8706038
(Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoate (PubChem CID 8706038) has the molecular formula C18H16ClN4O2S- and a molecular weight of 387.87 g/mol. Its IUPAC name is (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoate.
| Compound Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8706038 |
| Molecular Formula | C18H16ClN4O2S- |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,5-trimethylpyrrol-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C(\Sc2n[nH]c(-c3ccc(Cl)cc3)n2)C(=O)[O-])c(C)n1C |
| InChI | InChI=1S/C18H17ClN4O2S/c1-10-8-13(11(2)23(10)3)9-15(17(24)25)26-18-20-16(21-22-18)12-4-6-14(19)7-5-12/h4-9H,1-3H3,(H,24,25)(H,20,21,22)/p-1/b15-9- |
| InChIKey | ITAUHGNHESGISX-DHDCSXOGSA-M |
| XLogP | 2.96 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|