C16H11ClN3O2S2- — CID 8706065
(Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylthiophen-2-yl)prop-2-enoate (PubChem CID 8706065) has the molecular formula C16H11ClN3O2S2- and a molecular weight of 376.87 g/mol. Its IUPAC name is (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylthiophen-2-yl)prop-2-enoate.
| Compound Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8706065 |
| Molecular Formula | C16H11ClN3O2S2- |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(3-methylthiophen-2-yl)prop-2-enoate |
| SMILES | Cc1ccsc1/C=C(\Sc1n[nH]c(-c2ccc(Cl)cc2)n1)C(=O)[O-] |
| InChI | InChI=1S/C16H12ClN3O2S2/c1-9-6-7-23-12(9)8-13(15(21)22)24-16-18-14(19-20-16)10-2-4-11(17)5-3-10/h2-8H,1H3,(H,21,22)(H,18,19,20)/p-1/b13-8- |
| InChIKey | LIPARUDJXYSOLM-JYRVWZFOSA-M |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|