C15H9ClN4O5S — CID 8706008
(Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(5-nitrofuran-2-yl)prop-2-enoic acid (PubChem CID 8706008) has the molecular formula C15H9ClN4O5S and a molecular weight of 392.78 g/mol. Its IUPAC name is (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(5-nitrofuran-2-yl)prop-2-enoic acid.
| Compound Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 8706008 |
| Molecular Formula | C15H9ClN4O5S |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (Z)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccc([N+](=O)[O-])o1)Sc1n[nH]c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H9ClN4O5S/c16-9-3-1-8(2-4-9)13-17-15(19-18-13)26-11(14(21)22)7-10-5-6-12(25-10)20(23)24/h1-7H,(H,21,22)(H,17,18,19)/b11-7- |
| InChIKey | ZERYJGJGPJNLKY-XFFZJAGNSA-N |
| XLogP | 3.84 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|