C17H10Cl2N3O2S- — CID 8705985
(Z)-3-(4-chlorophenyl)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]prop-2-enoate (PubChem CID 8705985) has the molecular formula C17H10Cl2N3O2S- and a molecular weight of 391.26 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]prop-2-enoate.
| Compound Name | (Z)-3-(4-chlorophenyl)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 8705985 |
| Molecular Formula | C17H10Cl2N3O2S- |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-2-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]prop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1ccc(Cl)cc1)Sc1n[nH]c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H11Cl2N3O2S/c18-12-5-1-10(2-6-12)9-14(16(23)24)25-17-20-15(21-22-17)11-3-7-13(19)8-4-11/h1-9H,(H,23,24)(H,20,21,22)/p-1/b14-9- |
| InChIKey | FBXVBQCORWIQFN-ZROIWOOFSA-M |
| XLogP | 3.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|